![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 8A - Truly One.mp3 | 2013-10-30 18:20 | 5.3M | |
| 11A - Valley Of The Shadows..mp3 | 2013-10-30 18:21 | 4.2M | |
| 5A - Fathom.mp3 | 2014-02-21 16:34 | 14M | |
| 7A - Medicina.mp3 | 2014-02-21 16:34 | 15M | |
| 1A - Affirmative Action.mp3 | 2014-02-21 16:34 | 14M | |
| 11A or 2B - Cold Flow.mp3 | 2014-02-21 16:35 | 13M | |
| 2A - Touch Expert.mp3 | 2014-02-21 16:35 | 13M | |
| 4A - Akakor.mp3 | 2014-02-21 16:35 | 13M | |
| 11A or 2B - Only One Possible Future.mp3 | 2014-02-21 16:35 | 13M | |
| 12A - Codebreaker.mp3 | 2014-02-21 16:35 | 12M | |
| 4A - Kick The Flow.mp3 | 2014-02-21 16:35 | 13M | |
| 5A or 8B - Asteria.mp3 | 2014-02-21 16:35 | 15M | |
| 1A - Screwball.mp3 | 2014-02-21 16:35 | 12M | |
| 5A - Visage of War.mp3 | 2014-02-21 16:35 | 15M | |
| 12A - Archive.mp3 | 2014-02-21 16:35 | 15M | |
| 4A - EssentialTremor.mp3 | 2014-02-21 16:36 | 15M | |
| 9A - What Do I Do.mp3 | 2014-02-21 16:36 | 14M | |
| 4A - Kingston.mp3 | 2014-02-21 16:36 | 13M | |
| 7A - Reflected.mp3 | 2014-02-21 16:36 | 14M | |
| 9A - Tripwire.mp3 | 2014-02-21 16:36 | 16M | |
| 6A - Suffocate.mp3 | 2014-02-21 16:36 | 13M | |
| 4A - Dawn Of Time.mp3 | 2014-02-21 16:36 | 15M | |
| 4A - Mudshark.mp3 | 2014-02-21 16:36 | 12M | |
| 5A - Last Few Minutes.mp3 | 2014-02-21 16:36 | 14M | |
| 4A - Nomad.mp3 | 2014-02-21 16:36 | 14M | |
| 9A - Locked.mp3 | 2014-02-21 16:36 | 14M | |
| 12A - Wildfire.mp3 | 2014-02-21 16:36 | 13M | |
| 1A - The Joker.mp3 | 2014-02-21 16:37 | 13M | |
| 4A - Full Measure.mp3 | 2014-02-21 16:37 | 15M | |
| 7A - No One Here.mp3 | 2014-02-21 16:37 | 10M | |
| 4A - 7 Deadly Sins.mp3 | 2014-03-26 11:00 | 12M | |
| 10A - Trapped.mp3 | 2014-04-21 18:36 | 13M | |
| 6A or 4A - Illusion.mp3 | 2014-04-21 18:36 | 13M | |
| 9A - All Because of You.mp3 | 2014-04-21 18:36 | 9.7M | |
| 8B - Remorse.mp3 | 2014-04-21 18:36 | 11M | |
| 11A - Cyclone.mp3 | 2014-04-21 18:36 | 11M | |
| 4A - Crowd Reaction.mp3 | 2014-06-21 18:19 | 10M | |
| 1A - Breath.mp3 | 2014-06-21 18:19 | 11M | |
| 1A - Monkey Bread.mp3 | 2014-06-21 18:19 | 12M | |
| 4A - Glacier.mp3 | 2014-06-21 18:19 | 14M | |
| 4A - Nightmare.mp3 | 2014-06-21 18:19 | 9.8M | |
| 9A - Countdown.mp3 | 2014-06-21 18:19 | 11M | |
| 4A - The Clock Ticks.mp3 | 2014-06-21 18:20 | 13M | |
| 7A - New Design.mp3 | 2014-06-21 18:20 | 15M | |
| 4A - Devotion.mp3 | 2014-06-21 18:20 | 11M | |
| 9A - Phase Align.mp3 | 2014-06-21 18:20 | 11M | |
| 4A - Crossover.mp3 | 2014-06-21 18:20 | 10M | |
| 1A - Wires.mp3 | 2014-06-21 18:20 | 16M | |
| 6A - Microbe.mp3 | 2014-06-21 18:20 | 12M | |
| 3A - Dystronic.mp3 | 2014-06-21 18:20 | 13M | |
| 5A - Terminal.mp3 | 2014-06-21 18:20 | 9.8M | |
| 2B - Kestral.mp3 | 2014-08-21 16:14 | 11M | |
| 4A - A Little Mad.mp3 | 2014-08-21 16:14 | 10M | |
| 4A - M I R.mp3 | 2014-08-21 16:14 | 12M | |
| 1A - Mindbomb.mp3 | 2014-08-21 16:14 | 10M | |
| 4A - Nyctophilia.mp3 | 2014-08-21 16:14 | 11M | |
| 4A - New Spirit.mp3 | 2014-08-21 16:14 | 11M | |
| 7B - Know Your Role.mp3 | 2014-08-21 16:14 | 12M | |
| 3A - Outside.mp3 | 2014-08-21 16:14 | 14M | |
| 12A - Terra.mp3 | 2014-08-21 16:14 | 13M | |
| 9A - 4th State.mp3 | 2014-09-07 15:22 | 11M | |
| 4A - Black Heart.mp3 | 2014-09-07 15:22 | 11M | |
| 4A - Quiet Storm.mp3 | 2014-09-07 15:22 | 12M | |
| 6A - State of the Art.mp3 | 2014-09-07 15:23 | 11M | |
| 6A - Tip the Scales.mp3 | 2014-09-07 15:23 | 10M | |
| 4A - Headroom.mp3 | 2014-09-07 15:23 | 12M | |
| 4A - Here We Go Again.mp3 | 2014-09-07 15:23 | 12M | |